Chemical ID |
Chemical Name |
Interaction |
Interaction Action |
Publication |
---|
D000074 |
Acenocoumarol |
CYP4F2 gene polymorphism affects the susceptibility to Acenocoumarol | affects response to substance | 19578179
|
D016604 |
Aflatoxin B1 |
Aflatoxin B1 affects the expression of CYP4F2 protein | affects expression | 20106945
|
D001564 |
Benzo(a)pyrene |
Benzo(a)pyrene results in decreased expression of CYP4F2 mRNA | decreases expression | 20106945
|
D002995 |
Clofibric Acid |
[Diethylnitrosamine co-treated with Clofibric Acid] affects the expression of CYP4F2 mRNA | affects cotreatment|affects expression | 17602206
|
D016572 |
Cyclosporine |
Cyclosporine results in decreased expression of CYP4F2 mRNA | decreases expression | 20106945
|
D004052 |
Diethylnitrosamine |
[Diethylnitrosamine co-treated with Clofibric Acid] affects the expression of CYP4F2 mRNA | affects cotreatment|affects expression | 17602206
|
D004052 |
Diethylnitrosamine |
[Diethylnitrosamine co-treated with kojic acid co-treated with Diethylnitrosamine] results in decreased expression of CYP4F2 mRNA | affects cotreatment|decreases expression | 18544905
|
D004052 |
Diethylnitrosamine |
Diethylnitrosamine results in decreased expression of CYP4F2 mRNA | decreases expression | 19638242
|
D004958 |
Estradiol |
Estradiol results in decreased expression of CYP4F2 mRNA | decreases expression | 20106945
|
D011345 |
Fenofibrate |
Fenofibrate results in decreased expression of CYP4F2 protein | decreases expression | 15964316
|
D007654 |
Ketoconazole |
Ketoconazole results in decreased activity of CYP4F2 protein | decreases activity | 14709627
|
C011890 |
kojic acid |
[Diethylnitrosamine co-treated with kojic acid co-treated with Diethylnitrosamine] results in decreased expression of CYP4F2 mRNA | affects cotreatment|decreases expression | 18544905
|
C503100 |
N-(3-chloro-4-morpholin-4-yl) phenyl-N'-hydroxyimido formamide |
N-(3-chloro-4-morpholin-4-yl) phenyl-N'-hydroxyimido formamide results in decreased activity of CYP4F2 protein | decreases activity | 15831442
|
C006253 |
pirinixic acid |
[pirinixic acid binds to and results in increased activity of PPARA protein] which results in decreased expression of CYP4F2 mRNA | affects binding|decreases expression|increases activity | 19710929
|
C006253 |
pirinixic acid |
pirinixic acid results in decreased expression of CYP4F2 protein | decreases expression | 15964316
|
D014812 |
Vitamin K |
CYP4F2 protein affects the metabolism of Vitamin K | affects metabolic processing | 19741565
|
D014859 |
Warfarin |
CYP4F2 gene affects the susceptibility to Warfarin | affects response to substance | 19207028
|
D014859 |
Warfarin |
CYP4F2 gene polymorphism affects the susceptibility to Warfarin | affects response to substance | 19270263 20217574 19300499
|
Disease ID |
Disease Name |
Direct Evidence |
Inference Chemical Name |
Inference Score |
Publication |
---|
MESH:D055371 |
Acute Lung Injury |
|
pirinixic acid |
3.17 | 18653653 |
MESH:D000230 |
Adenocarcinoma |
|
Benzo(a)pyrene |
4.32 | 20464547 20127859 |
MESH:D000230 |
Adenocarcinoma |
|
Estradiol |
4.32 | 11473722 |
MESH:D000236 |
Adenoma |
|
Benzo(a)pyrene |
6.73 | 6695378 |
MESH:D000236 |
Adenoma |
|
Diethylnitrosamine |
6.73 | 6695378 10737359 |
MESH:D018248 |
Adenoma, Liver Cell |
|
Diethylnitrosamine |
10.37 | 17162532 19052882 18056438 17620307 16434500 19061943 |
MESH:D018248 |
Adenoma, Liver Cell |
|
pirinixic acid |
10.37 | 16434500 |
MESH:D017544 |
Aortic Aneurysm, Abdominal |
|
Benzo(a)pyrene |
4.15 | 19183758 |
MESH:D001778 |
Blood Coagulation Disorders |
|
pirinixic acid |
3.20 | 19483382 |
MESH:D001943 |
Breast Neoplasms |
|
Benzo(a)pyrene |
1.86 | 17474063 20146248 |
MESH:D001943 |
Breast Neoplasms |
|
Diethylnitrosamine |
1.86 | 17474063 |
MESH:D001943 |
Breast Neoplasms |
|
Estradiol |
1.86 | 19861407 16675129 17261762 12948864 17289903 14630087 17018787 18497071 |
MESH:D002181 |
Candidiasis, Vulvovaginal |
|
Estradiol |
4.55 | 16111702 |
MESH:D006528 |
Carcinoma, Hepatocellular |
|
Aflatoxin B1 |
6.76 | 12619106 21507988 12907637 |
MESH:D006528 |
Carcinoma, Hepatocellular |
|
Diethylnitrosamine |
6.76 | 18785209 16288022 16807293 20524982 18665156 17428255 19519916 18506893 18978308 20935162 19822196 17138121 20084675 17978847 19394651 19171122 19335982 17173139 3581430 19539802 19418558 11831363 21159647 17162532 16698587 16569478 10737359 16328049 20512989 19052882 20007298 18691550 16540662 16935385 16830150 18494052 16779866 16681979 19701751 17055752 19208518 19107877 20514400 20101231 18210153 20214788 20727157 3084413 18056438 20432363 19383236 18393292 16502159 17761372 10672840 18971187 16878318 19919837 18788625 |
MESH:D006528 |
Carcinoma, Hepatocellular |
|
Estradiol |
6.76 | 16924424 |
MESH:D006528 |
Carcinoma, Hepatocellular |
|
Vitamin K |
6.76 | 16328049 |
MESH:D002294 |
Carcinoma, Squamous Cell |
|
Benzo(a)pyrene |
2.06 | 20419170 |
MESH:D002471 |
Cell Transformation, Neoplastic |
|
Cyclosporine |
11.37 | 12371664 |
MESH:D002471 |
Cell Transformation, Neoplastic |
|
Diethylnitrosamine |
11.37 | 17174075 7505956 21159647 2727394 |
MESH:D002471 |
Cell Transformation, Neoplastic |
|
Estradiol |
11.37 | 18566989 |
MESH:D002543 |
Cerebral Hemorrhage |
|
Warfarin |
5.91 | 11061249 |
MESH:D018281 |
Cholangiocarcinoma |
|
Diethylnitrosamine |
3.73 | 19052882 |
MESH:D002779 |
Cholestasis |
|
Cyclosporine |
7.89 | 19486331 |
MESH:D002779 |
Cholestasis |
|
pirinixic acid |
7.89 | 19176532 |
MESH:D023903 |
Coronary Restenosis |
|
Warfarin |
5.74 | 12872399 |
OMIM:122700 |
COUMARIN RESISTANCE |
|
Warfarin |
5.88 | 20497562 20579077 |
MESH:D003876 |
Dermatitis, Atopic |
|
pirinixic acid |
2.45 | 18249437 |
MESH:D003922 |
Diabetes Mellitus, Type 1 |
|
Warfarin |
4.07 | 18772604 |
MESH:D003924 |
Diabetes Mellitus, Type 2 |
|
Diethylnitrosamine |
2.20 | 20387270 |
MESH:D003928 |
Diabetic Nephropathies |
|
Estradiol |
9.60 | 19279558 |
MESH:D003928 |
Diabetic Nephropathies |
|
Warfarin |
9.60 | 12644472 |
MESH:D003875 |
Drug Eruptions |
|
Warfarin |
6.05 | 14723717 |
MESH:D056486 |
Drug-Induced Liver Injury |
|
Diethylnitrosamine |
4.48 | 19107877 |
MESH:D056486 |
Drug-Induced Liver Injury |
|
Ketoconazole |
4.48 | 18289764 |
MESH:D050171 |
Dyslipidemias |
|
Fenofibrate |
4.46 | 16707586 |
MESH:D004487 |
Edema |
|
pirinixic acid |
2.53 | 12083418 |
MESH:D016889 |
Endometrial Neoplasms |
|
Estradiol |
7.89 | 18566989 11473722 19148513 |
MESH:D016889 |
Endometrial Neoplasms |
|
Fenofibrate |
7.89 | 16569247 |
MESH:D004931 |
Esophageal Achalasia |
|
Diethylnitrosamine |
5.21 | 16302075 |
MESH:D004938 |
Esophageal Neoplasms |
|
Benzo(a)pyrene |
2.02 | 16530937 |
MESH:D005234 |
Fatty Liver |
|
Cyclosporine |
13.37 | 19224547 |
MESH:D005234 |
Fatty Liver |
|
Diethylnitrosamine |
13.37 | 21071580 20387270 |
MESH:D005234 |
Fatty Liver |
|
pirinixic acid |
13.37 | 19236843 20131406 |
MESH:D005355 |
Fibrosis |
|
Cyclosporine |
3.21 | 12639820 12168785 |
MESH:D006471 |
Gastrointestinal Hemorrhage |
|
Warfarin |
6.81 | 11794436 |
MESH:D005776 |
Gaucher Disease |
|
Warfarin |
6.02 | 12359135 |
MESH:D005885 |
Gingival Hyperplasia |
|
Cyclosporine |
4.30 | 8708960 |
MESH:D006330 |
Heart Defects, Congenital |
|
Benzo(a)pyrene |
2.68 | 20471113 |
MESH:D006333 |
Heart Failure |
|
pirinixic acid |
2.57 | 20558911 |
MESH:D006406 |
Hematoma |
|
Warfarin |
6.81 | 17493413 |
MESH:D006457 |
Hemoglobinuria, Paroxysmal |
|
Cyclosporine |
4.50 | 15720958 |
MESH:D006470 |
Hemorrhage |
|
Warfarin |
5.51 | 18429757 |
MESH:D006529 |
Hepatomegaly |
|
pirinixic acid |
3.07 | 19772884 18467677 19176532 16221962 |
MESH:D006558 |
Herpes Genitalis |
|
Estradiol |
5.13 | 15709030 |
MESH:D019584 |
Hot Flashes |
|
Estradiol |
3.85 | 17088409 |
MESH:D006943 |
Hyperglycemia |
|
pirinixic acid |
3.23 | 20558911 |
MESH:D006973 |
Hypertension |
|
Cyclosporine |
2.12 | 10903974 |
MESH:D006976 |
Hypertension, Pulmonary |
|
Warfarin |
4.84 | 12359135 |
MESH:D007249 |
Inflammation |
|
Diethylnitrosamine |
2.40 | 18785209 |
MESH:D007333 |
Insulin Resistance |
|
Estradiol |
7.31 | 16393666 16627594 |
MESH:D007333 |
Insulin Resistance |
|
pirinixic acid |
7.31 | 16306350 |
MESH:D007638 |
Keratoconjunctivitis Sicca |
|
Cyclosporine |
4.54 | 15604871 |
MESH:D007674 |
Kidney Diseases |
|
Cyclosporine |
6.04 | 8314463 10903974 18776723 |
MESH:D007674 |
Kidney Diseases |
|
Estradiol |
6.04 | 15618244 |
MESH:D007680 |
Kidney Neoplasms |
|
Cyclosporine |
7.42 | 12371664 |
MESH:D007680 |
Kidney Neoplasms |
|
Estradiol |
7.42 | 15610895 |
MESH:D016773 |
Leishmaniasis, Cutaneous |
|
Ketoconazole |
4.74 | 8889330 2166429 19744259 1311351 |
MESH:D007898 |
Leishmaniasis, Visceral |
|
Ketoconazole |
4.58 | 11332679 |
MESH:D008064 |
Lipidoses |
|
Ketoconazole |
4.60 | 17567588 |
MESH:D054068 |
Livedo Reticularis |
|
Warfarin |
6.81 | 18280355 |
MESH:D008103 |
Liver Cirrhosis |
|
Diethylnitrosamine |
2.85 | 20032147 18407596 18522880 19638242 18665156 |
MESH:D008106 |
Liver Cirrhosis, Experimental |
|
Estradiol |
3.62 | 14716833 14659978 |
MESH:D008106 |
Liver Cirrhosis, Experimental |
|
Fenofibrate |
3.62 | 15474484 |
MESH:D008106 |
Liver Cirrhosis, Experimental |
|
pirinixic acid |
3.62 | 15474484 |
MESH:D008107 |
Liver Diseases |
|
Diethylnitrosamine |
2.11 | 17034775 |
MESH:D008113 |
Liver Neoplasms |
|
Aflatoxin B1 |
18.26 | 9163691 18177683 2125692 15890375 |
MESH:D008113 |
Liver Neoplasms |
|
Benzo(a)pyrene |
18.26 | 21137059 20195826 |
MESH:D008113 |
Liver Neoplasms |
|
Clofibric Acid |
18.26 | 17602206 |
MESH:D008113 |
Liver Neoplasms |
|
Diethylnitrosamine |
18.26 | 19294768 19073162 18754104 19255062 19090486 19642983 18644402 19551842 20452335 21167192 15885732 21071580 20501860 2422723 18978307 20434301 15175105 20405173 20118626 19427195 19812893 2862719 19499222 10737359 20101389 20492335 18648771 19850985 19638242 20583210 19254457 19833225 18977376 16942905 12112319 21047994 9163691 19996281 19256749 21278145 19426721 12771043 19690152 20137499 |
MESH:D008113 |
Liver Neoplasms |
|
Fenofibrate |
18.26 | 18978307 |
MESH:D008113 |
Liver Neoplasms |
|
pirinixic acid |
18.26 | 15890375 20007298 16377806 |
MESH:D008114 |
Liver Neoplasms, Experimental |
|
Aflatoxin B1 |
14.50 | 8603461 |
MESH:D008114 |
Liver Neoplasms, Experimental |
|
Diethylnitrosamine |
14.50 | 18308698 18079962 19126423 19009564 17854601 21159647 16842330 18544905 9362446 17174075 18093689 19004024 17942915 16267830 18282651 18775883 19519916 19539802 3124819 18253720 2563599 18164116 |
MESH:D008114 |
Liver Neoplasms, Experimental |
|
Fenofibrate |
14.50 | 18253720 18775883 |
MESH:D008114 |
Liver Neoplasms, Experimental |
|
kojic acid |
14.50 | 18544905 |
MESH:D008175 |
Lung Neoplasms |
|
Aflatoxin B1 |
3.46 | 14755239 |
MESH:D008175 |
Lung Neoplasms |
|
Benzo(a)pyrene |
3.46 | 20464547 20869020 18520028 6695378 20135361 20064080 17053015 18816296 18569708 |
MESH:D008175 |
Lung Neoplasms |
|
Diethylnitrosamine |
3.46 | 20970405 6695378 20512841 21163286 |
MESH:D008325 |
Mammary Neoplasms, Experimental |
|
Estradiol |
2.59 | 16891317 17203775 11408345 11807958 |
MESH:D020149 |
Manganese Poisoning |
|
Estradiol |
4.58 | 19453300 |
MESH:D008664 |
Metal Metabolism, Inborn Errors |
|
Cyclosporine |
4.88 | 16801185 |
MESH:D009062 |
Mouth Neoplasms |
|
Benzo(a)pyrene |
3.23 | 16381670 |
MESH:D009135 |
Muscular Diseases |
|
pirinixic acid |
3.58 | 16239165 |
MESH:D009203 |
Myocardial Infarction |
|
pirinixic acid |
2.16 | 19151258 |
MESH:D015428 |
Myocardial Reperfusion Injury |
|
Estradiol |
8.39 | 16810080 |
MESH:D015428 |
Myocardial Reperfusion Injury |
|
pirinixic acid |
8.39 | 16411023 |
MESH:D009336 |
Necrosis |
|
Warfarin |
5.63 | 14723717 |
MESH:D009362 |
Neoplasm Metastasis |
|
Diethylnitrosamine |
2.59 | 9029167 3581430 |
MESH:D009369 |
Neoplasms |
|
Benzo(a)pyrene |
4.90 | 11141357 |
MESH:D009369 |
Neoplasms |
|
pirinixic acid |
4.90 | 17405874 |
MESH:D009389 |
Neovascularization, Pathologic |
|
Estradiol |
3.81 | 17289903 |
MESH:D009402 |
Nephrosis, Lipoid |
|
Cyclosporine |
4.54 | 17954296 |
MESH:D009404 |
Nephrotic Syndrome |
|
Cyclosporine |
3.33 | 19348381 18481113 |
MESH:D009421 |
Nervous System Malformations |
|
Estradiol |
3.72 | 11399458 16427766 |
MESH:D019636 |
Neurodegenerative Diseases |
|
Diethylnitrosamine |
3.39 | 20387270 |
MESH:D009461 |
Neurologic Manifestations |
|
Diethylnitrosamine |
5.21 | 20387270 |
MESH:D009765 |
Obesity |
|
pirinixic acid |
1.82 | 20558911 |
MESH:D010051 |
Ovarian Neoplasms |
|
Estradiol |
2.23 | 19401270 |
MESH:D010190 |
Pancreatic Neoplasms |
|
Diethylnitrosamine |
2.44 | 16540662 |
MESH:D011230 |
Precancerous Conditions |
|
Cyclosporine |
9.10 | 12371664 |
MESH:D011230 |
Precancerous Conditions |
|
Diethylnitrosamine |
9.10 | 2563599 |
MESH:D019048 |
Prostatic Intraepithelial Neoplasia |
|
Estradiol |
3.94 | 20887781 |
MESH:D011471 |
Prostatic Neoplasms |
|
Benzo(a)pyrene |
2.69 | 17292933 |
MESH:D011471 |
Prostatic Neoplasms |
|
Estradiol |
2.69 | 16740699 |
MESH:D011471 |
Prostatic Neoplasms |
|
Ketoconazole |
2.69 | 17404083 |
MESH:D020151 |
Protein C Deficiency |
|
Warfarin |
6.43 | 18376272 |
MESH:D011565 |
Psoriasis |
|
Cyclosporine |
2.24 | 16882103 |
MESH:D011655 |
Pulmonary Embolism |
|
Warfarin |
6.43 | 19300499 |
MESH:D015427 |
Reperfusion Injury |
|
pirinixic acid |
2.41 | 19058328 |
MESH:D012851 |
Sinus Thrombosis, Intracranial |
|
Warfarin |
5.94 | 12269725 |
MESH:D012878 |
Skin Neoplasms |
|
Benzo(a)pyrene |
2.39 | 10029692 19755658 |
MESH:D013274 |
Stomach Neoplasms |
|
Benzo(a)pyrene |
2.34 | 20155912 2093021 |
MESH:D013274 |
Stomach Neoplasms |
|
Diethylnitrosamine |
2.34 | 18456281 |
MESH:D020521 |
Stroke |
|
Warfarin |
5.02 | 19300499 |
MESH:D013923 |
Thromboembolism |
|
Acenocoumarol |
14.47 | 18698879 |
MESH:D013923 |
Thromboembolism |
|
Warfarin |
14.47 | 16960144 18698879 |
MESH:D019851 |
Thrombophilia |
|
Warfarin |
5.65 | 17493413 |
MESH:D013927 |
Thrombosis |
|
Warfarin |
5.17 | 11307788 17245631 17672075 11518727 19300499 15720958 |
MESH:D013964 |
Thyroid Neoplasms |
|
Diethylnitrosamine |
3.02 | 7505956 |
MESH:D013978 |
Tibial Fractures |
|
Estradiol |
4.78 | 19048282 |
MESH:D001749 |
Urinary Bladder Neoplasms |
|
Benzo(a)pyrene |
2.20 | 17053015 |
MESH:D014605 |
Uveitis |
|
Cyclosporine |
4.08 | 1336536 |
MESH:D014657 |
Vasculitis |
|
Warfarin |
5.94 | 20337814 |
MESH:D054556 |
Venous Thromboembolism |
|
Warfarin |
6.46 | 18776969 |
MESH:D020246 |
Venous Thrombosis |
|
Warfarin |
5.56 | 15733061 14723717 |
MESH:D014985 |
Xerophthalmia |
|
Cyclosporine |
4.54 | 17120751 |